About 1-carbamimidoylguanidine;octanedioic acid
1-carbamimidoylguanidine;octanedioic acid (PubChem CID 176518629) has the molecular formula C10H21N5O4
and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-carbamimidoylguanidine;octanedioic acid.
Molecular Properties
| Compound Name | 1-carbamimidoylguanidine;octanedioic acid |
| PubChem CID | 176518629 |
| Molecular Formula | C10H21N5O4 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-carbamimidoylguanidine;octanedioic acid |
| SMILES | O=C(O)CCCCCCC(=O)O.[H]/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C8H14O4.C2H7N5/c9-7(10)5-3-1-2-4-6-8(11)12;3-1(4)7-2(5)6/h1-6H2,(H,9,10)(H,11,12);(H7,3,4,5,6,7) |
| InChIKey | ZNIIJCPXQUQLRJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoylguanidine;octanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoylguanidine;octanedioic acid?
The IUPAC name of 1-carbamimidoylguanidine;octanedioic acid (CID 176518629) is 1-carbamimidoylguanidine;octanedioic acid.
What is the SMILES notation for 1-carbamimidoylguanidine;octanedioic acid?
The canonical SMILES for 1-carbamimidoylguanidine;octanedioic acid is O=C(O)CCCCCCC(=O)O.[H]/N=C(\N)N/C(N)=N/[H].
What is the InChIKey of 1-carbamimidoylguanidine;octanedioic acid?
The InChIKey is ZNIIJCPXQUQLRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4.C2H7N5/c9-7(10)5-3-1-2-4-6-8(11)12;3-1(4)7-2(5)6/h1-6H2,(H,9,10)(H,11,12);(H7,3,4,5,6,7).
What are the key properties of 1-carbamimidoylguanidine;octanedioic acid?
1-carbamimidoylguanidine;octanedioic acid has a molecular weight of 275.31 g/mol, XLogP of -0.14, 7 rotatable bonds, 7 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoylguanidine;octanedioic acid is sourced from PubChem (CID 176518629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).