About 7-hydroxyheptanimidamide;hydrochloride
7-hydroxyheptanimidamide;hydrochloride (PubChem CID 158249360) has the molecular formula C7H17ClN2O
and a molecular weight of 180.68 g/mol. Its IUPAC name is 7-hydroxyheptanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 7-hydroxyheptanimidamide;hydrochloride |
| PubChem CID | 158249360 |
| Molecular Formula | C7H17ClN2O |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 7-hydroxyheptanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CCCCCCO |
| InChI | InChI=1S/C7H16N2O.ClH/c8-7(9)5-3-1-2-4-6-10;/h10H,1-6H2,(H3,8,9);1H |
| InChIKey | NDDFKXRNCNTYBW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxyheptanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxyheptanimidamide;hydrochloride?
The IUPAC name of 7-hydroxyheptanimidamide;hydrochloride (CID 158249360) is 7-hydroxyheptanimidamide;hydrochloride.
What is the SMILES notation for 7-hydroxyheptanimidamide;hydrochloride?
The canonical SMILES for 7-hydroxyheptanimidamide;hydrochloride is Cl.[H]/N=C(\N)CCCCCCO.
What is the InChIKey of 7-hydroxyheptanimidamide;hydrochloride?
The InChIKey is NDDFKXRNCNTYBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O.ClH/c8-7(9)5-3-1-2-4-6-10;/h10H,1-6H2,(H3,8,9);1H.
What are the key properties of 7-hydroxyheptanimidamide;hydrochloride?
7-hydroxyheptanimidamide;hydrochloride has a molecular weight of 180.68 g/mol, XLogP of 1.29, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxyheptanimidamide;hydrochloride is sourced from PubChem (CID 158249360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).