About formic acid;octadecanimidamide
formic acid;octadecanimidamide (PubChem CID 160757976) has the molecular formula C19H40N2O2
and a molecular weight of 328.54 g/mol. Its IUPAC name is formic acid;octadecanimidamide.
Molecular Properties
| Compound Name | formic acid;octadecanimidamide |
| PubChem CID | 160757976 |
| Molecular Formula | C19H40N2O2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | formic acid;octadecanimidamide |
| SMILES | O=CO.[H]/N=C(\N)CCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C18H38N2.CH2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1-3/h2-17H2,1H3,(H3,19,20);1H,(H,2,3) |
| InChIKey | RXRISXPXDLMBSZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze formic acid;octadecanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;octadecanimidamide?
The IUPAC name of formic acid;octadecanimidamide (CID 160757976) is formic acid;octadecanimidamide.
What is the SMILES notation for formic acid;octadecanimidamide?
The canonical SMILES for formic acid;octadecanimidamide is O=CO.[H]/N=C(\N)CCCCCCCCCCCCCCCCC.
What is the InChIKey of formic acid;octadecanimidamide?
The InChIKey is RXRISXPXDLMBSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2.CH2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1-3/h2-17H2,1H3,(H3,19,20);1H,(H,2,3).
What are the key properties of formic acid;octadecanimidamide?
formic acid;octadecanimidamide has a molecular weight of 328.54 g/mol, XLogP of 5.88, 16 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;octadecanimidamide is sourced from PubChem (CID 160757976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).