About ethyl formate;pentanimidamide;1H-pyrrole
ethyl formate;pentanimidamide;1H-pyrrole (PubChem CID 174756411) has the molecular formula C12H23N3O2
and a molecular weight of 241.34 g/mol. Its IUPAC name is ethyl formate;pentanimidamide;1H-pyrrole.
Molecular Properties
| Compound Name | ethyl formate;pentanimidamide;1H-pyrrole |
| PubChem CID | 174756411 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | ethyl formate;pentanimidamide;1H-pyrrole |
| SMILES | CCOC=O.[H]/N=C(/N)CCCC.c1cc[nH]c1 |
| InChI | InChI=1S/C5H12N2.C4H5N.C3H6O2/c1-2-3-4-5(6)7;1-2-4-5-3-1;1-2-5-3-4/h2-4H2,1H3,(H3,6,7);1-5H;3H,2H2,1H3 |
| InChIKey | WRAQEKRTMVJVGL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;pentanimidamide;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;pentanimidamide;1H-pyrrole?
The IUPAC name of ethyl formate;pentanimidamide;1H-pyrrole (CID 174756411) is ethyl formate;pentanimidamide;1H-pyrrole.
What is the SMILES notation for ethyl formate;pentanimidamide;1H-pyrrole?
The canonical SMILES for ethyl formate;pentanimidamide;1H-pyrrole is CCOC=O.[H]/N=C(/N)CCCC.c1cc[nH]c1.
What is the InChIKey of ethyl formate;pentanimidamide;1H-pyrrole?
The InChIKey is WRAQEKRTMVJVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.C4H5N.C3H6O2/c1-2-3-4-5(6)7;1-2-4-5-3-1;1-2-5-3-4/h2-4H2,1H3,(H3,6,7);1-5H;3H,2H2,1H3.
What are the key properties of ethyl formate;pentanimidamide;1H-pyrrole?
ethyl formate;pentanimidamide;1H-pyrrole has a molecular weight of 241.34 g/mol, XLogP of 2.31, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;pentanimidamide;1H-pyrrole is sourced from PubChem (CID 174756411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).