About 4-hexoxybutanimidamide
4-hexoxybutanimidamide (PubChem CID 29003057) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-hexoxybutanimidamide.
Molecular Properties
| Compound Name | 4-hexoxybutanimidamide |
| PubChem CID | 29003057 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-hexoxybutanimidamide |
| SMILES | [H]/N=C(\N)CCCOCCCCCC |
| InChI | InChI=1S/C10H22N2O/c1-2-3-4-5-8-13-9-6-7-10(11)12/h2-9H2,1H3,(H3,11,12) |
| InChIKey | HFVKHXTYHHLSJH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hexoxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexoxybutanimidamide?
The IUPAC name of 4-hexoxybutanimidamide (CID 29003057) is 4-hexoxybutanimidamide.
What is the SMILES notation for 4-hexoxybutanimidamide?
The canonical SMILES for 4-hexoxybutanimidamide is [H]/N=C(\N)CCCOCCCCCC.
What is the InChIKey of 4-hexoxybutanimidamide?
The InChIKey is HFVKHXTYHHLSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-2-3-4-5-8-13-9-6-7-10(11)12/h2-9H2,1H3,(H3,11,12).
What are the key properties of 4-hexoxybutanimidamide?
4-hexoxybutanimidamide has a molecular weight of 186.30 g/mol, XLogP of 2.30, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxybutanimidamide is sourced from PubChem (CID 29003057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).