About pentanimidoyl iodide
pentanimidoyl iodide (PubChem CID 135251548) has the molecular formula C5H10IN
and a molecular weight of 211.05 g/mol. Its IUPAC name is pentanimidoyl iodide.
Molecular Properties
| Compound Name | pentanimidoyl iodide |
| PubChem CID | 135251548 |
| Molecular Formula | C5H10IN |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | pentanimidoyl iodide |
| SMILES | [H]/N=C(\I)CCCC |
| InChI | InChI=1S/C5H10IN/c1-2-3-4-5(6)7/h7H,2-4H2,1H3/b7-5- |
| InChIKey | YSLKDIIIZXVGSL-ALCCZGGFSA-N |
| XLogP | 2.59 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze pentanimidoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanimidoyl iodide?
The IUPAC name of pentanimidoyl iodide (CID 135251548) is pentanimidoyl iodide.
What is the SMILES notation for pentanimidoyl iodide?
The canonical SMILES for pentanimidoyl iodide is [H]/N=C(\I)CCCC.
What is the InChIKey of pentanimidoyl iodide?
The InChIKey is YSLKDIIIZXVGSL-ALCCZGGFSA-N. The full InChI is InChI=1S/C5H10IN/c1-2-3-4-5(6)7/h7H,2-4H2,1H3/b7-5-.
What are the key properties of pentanimidoyl iodide?
pentanimidoyl iodide has a molecular weight of 211.05 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanimidoyl iodide is sourced from PubChem (CID 135251548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).