About 5-amino-4,6-diiminodecan-5-ol
5-amino-4,6-diiminodecan-5-ol (PubChem CID 163772694) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is 5-amino-4,6-diiminodecan-5-ol.
Molecular Properties
| Compound Name | 5-amino-4,6-diiminodecan-5-ol |
| PubChem CID | 163772694 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 5-amino-4,6-diiminodecan-5-ol |
| SMILES | [H]/N=C(\CCC)C(N)(O)/C(CCCC)=N/[H] |
| InChI | InChI=1S/C10H21N3O/c1-3-5-7-9(12)10(13,14)8(11)6-4-2/h11-12,14H,3-7,13H2,1-2H3/b11-8+,12-9+ |
| InChIKey | MHUIKBQSHSCEQS-HZOWPXDZSA-N |
| XLogP | 1.66 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4,6-diiminodecan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4,6-diiminodecan-5-ol?
The IUPAC name of 5-amino-4,6-diiminodecan-5-ol (CID 163772694) is 5-amino-4,6-diiminodecan-5-ol.
What is the SMILES notation for 5-amino-4,6-diiminodecan-5-ol?
The canonical SMILES for 5-amino-4,6-diiminodecan-5-ol is [H]/N=C(\CCC)C(N)(O)/C(CCCC)=N/[H].
What is the InChIKey of 5-amino-4,6-diiminodecan-5-ol?
The InChIKey is MHUIKBQSHSCEQS-HZOWPXDZSA-N. The full InChI is InChI=1S/C10H21N3O/c1-3-5-7-9(12)10(13,14)8(11)6-4-2/h11-12,14H,3-7,13H2,1-2H3/b11-8+,12-9+.
What are the key properties of 5-amino-4,6-diiminodecan-5-ol?
5-amino-4,6-diiminodecan-5-ol has a molecular weight of 199.30 g/mol, XLogP of 1.66, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4,6-diiminodecan-5-ol is sourced from PubChem (CID 163772694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).