C10H21N3O — CID 163772694
5-amino-4,6-diiminodecan-5-ol (PubChem CID 163772694) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 5-amino-4,6-diiminodecan-5-ol.
| Compound Name | 5-amino-4,6-diiminodecan-5-ol |
|---|---|
| PubChem CID | 163772694 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 5-amino-4,6-diiminodecan-5-ol |
| SMILES | [H]/N=C(\CCC)C(N)(O)/C(CCCC)=N/[H] |
| InChI | InChI=1S/C10H21N3O/c1-3-5-7-9(12)10(13,14)8(11)6-4-2/h11-12,14H,3-7,13H2,1-2H3/b11-8+,12-9+ |
| InChIKey | MHUIKBQSHSCEQS-HZOWPXDZSA-N |
| XLogP | 1.66 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|