About 2-iminohexanoic acid
2-iminohexanoic acid (PubChem CID 54447751) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-iminohexanoic acid.
Molecular Properties
| Compound Name | 2-iminohexanoic acid |
| PubChem CID | 54447751 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-iminohexanoic acid |
| SMILES | [H]/N=C(\CCCC)C(=O)O |
| InChI | InChI=1S/C6H11NO2/c1-2-3-4-5(7)6(8)9/h7H,2-4H2,1H3,(H,8,9)/b7-5+ |
| InChIKey | WSTCXUGSWREQFF-FNORWQNLSA-N |
| XLogP | 1.28 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminohexanoic acid?
The IUPAC name of 2-iminohexanoic acid (CID 54447751) is 2-iminohexanoic acid.
What is the SMILES notation for 2-iminohexanoic acid?
The canonical SMILES for 2-iminohexanoic acid is [H]/N=C(\CCCC)C(=O)O.
What is the InChIKey of 2-iminohexanoic acid?
The InChIKey is WSTCXUGSWREQFF-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-3-4-5(7)6(8)9/h7H,2-4H2,1H3,(H,8,9)/b7-5+.
What are the key properties of 2-iminohexanoic acid?
2-iminohexanoic acid has a molecular weight of 129.16 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminohexanoic acid is sourced from PubChem (CID 54447751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).