2-iminohexanoic acid

C6H11NO2 — CID 54447751

IUPAC2-iminohexanoic acid
SMILES[H]/N=C(\CCCC)C(=O)O
InChIInChI=1S/C6H11NO2/c1-2-3-4-5(7)6(8)9/h7H,2-4H2,1H3,(H,8,9)/b7-5+
InChIKeyWSTCXUGSWREQFF-FNORWQNLSA-N
MW129.16 g/mol
LogP1.28
Rot. Bonds4

About 2-iminohexanoic acid

2-iminohexanoic acid (PubChem CID 54447751) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-iminohexanoic acid.

Molecular Properties

Compound Name2-iminohexanoic acid
PubChem CID54447751
Molecular FormulaC6H11NO2
Molecular Weight129.16 g/mol
Exact Mass129.08
IUPAC Name2-iminohexanoic acid
SMILES[H]/N=C(\CCCC)C(=O)O
InChIInChI=1S/C6H11NO2/c1-2-3-4-5(7)6(8)9/h7H,2-4H2,1H3,(H,8,9)/b7-5+
InChIKeyWSTCXUGSWREQFF-FNORWQNLSA-N
XLogP1.28
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500129.16
LogP ≤ 51.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2-iminohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-iminohexanoic acid?
The IUPAC name of 2-iminohexanoic acid (CID 54447751) is 2-iminohexanoic acid.
What is the SMILES notation for 2-iminohexanoic acid?
The canonical SMILES for 2-iminohexanoic acid is [H]/N=C(\CCCC)C(=O)O.
What is the InChIKey of 2-iminohexanoic acid?
The InChIKey is WSTCXUGSWREQFF-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-3-4-5(7)6(8)9/h7H,2-4H2,1H3,(H,8,9)/b7-5+.
What are the key properties of 2-iminohexanoic acid?
2-iminohexanoic acid has a molecular weight of 129.16 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminohexanoic acid is sourced from PubChem (CID 54447751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).