About ethane;pentanoic acid
ethane;pentanoic acid (PubChem CID 142198531) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is ethane;pentanoic acid.
Molecular Properties
| Compound Name | ethane;pentanoic acid |
| PubChem CID | 142198531 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | ethane;pentanoic acid |
| SMILES | CC.CCCCC(=O)O |
| InChI | InChI=1S/C5H10O2.C2H6/c1-2-3-4-5(6)7;1-2/h2-4H2,1H3,(H,6,7);1-2H3 |
| InChIKey | CACJFBVHFOAPPJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pentanoic acid?
The IUPAC name of ethane;pentanoic acid (CID 142198531) is ethane;pentanoic acid.
What is the SMILES notation for ethane;pentanoic acid?
The canonical SMILES for ethane;pentanoic acid is CC.CCCCC(=O)O.
What is the InChIKey of ethane;pentanoic acid?
The InChIKey is CACJFBVHFOAPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C2H6/c1-2-3-4-5(6)7;1-2/h2-4H2,1H3,(H,6,7);1-2H3.
What are the key properties of ethane;pentanoic acid?
ethane;pentanoic acid has a molecular weight of 132.20 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pentanoic acid is sourced from PubChem (CID 142198531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).