About pentanoic acid;stannane
pentanoic acid;stannane (PubChem CID 173249748) has the molecular formula C5H14O2Sn
and a molecular weight of 224.88 g/mol. Its IUPAC name is pentanoic acid;stannane.
Molecular Properties
| Compound Name | pentanoic acid;stannane |
| PubChem CID | 173249748 |
| Molecular Formula | C5H14O2Sn |
| Molecular Weight | 224.88 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | pentanoic acid;stannane |
| SMILES | CCCCC(=O)O.[SnH4] |
| InChI | InChI=1S/C5H10O2.Sn.4H/c1-2-3-4-5(6)7;;;;;/h2-4H2,1H3,(H,6,7);;;;; |
| InChIKey | VAICMIIVFHZYTR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.88 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pentanoic acid;stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoic acid;stannane?
The IUPAC name of pentanoic acid;stannane (CID 173249748) is pentanoic acid;stannane.
What is the SMILES notation for pentanoic acid;stannane?
The canonical SMILES for pentanoic acid;stannane is CCCCC(=O)O.[SnH4].
What is the InChIKey of pentanoic acid;stannane?
The InChIKey is VAICMIIVFHZYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.Sn.4H/c1-2-3-4-5(6)7;;;;;/h2-4H2,1H3,(H,6,7);;;;;.
What are the key properties of pentanoic acid;stannane?
pentanoic acid;stannane has a molecular weight of 224.88 g/mol, XLogP of -0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoic acid;stannane is sourced from PubChem (CID 173249748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).