About pentanoic acid;urea;hydrochloride
pentanoic acid;urea;hydrochloride (PubChem CID 174794672) has the molecular formula C6H15ClN2O3
and a molecular weight of 198.65 g/mol. Its IUPAC name is pentanoic acid;urea;hydrochloride.
Molecular Properties
| Compound Name | pentanoic acid;urea;hydrochloride |
| PubChem CID | 174794672 |
| Molecular Formula | C6H15ClN2O3 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | pentanoic acid;urea;hydrochloride |
| SMILES | CCCCC(=O)O.Cl.NC(N)=O |
| InChI | InChI=1S/C5H10O2.CH4N2O.ClH/c1-2-3-4-5(6)7;2-1(3)4;/h2-4H2,1H3,(H,6,7);(H4,2,3,4);1H |
| InChIKey | IJJGNKYBCYCDPL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentanoic acid;urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoic acid;urea;hydrochloride?
The IUPAC name of pentanoic acid;urea;hydrochloride (CID 174794672) is pentanoic acid;urea;hydrochloride.
What is the SMILES notation for pentanoic acid;urea;hydrochloride?
The canonical SMILES for pentanoic acid;urea;hydrochloride is CCCCC(=O)O.Cl.NC(N)=O.
What is the InChIKey of pentanoic acid;urea;hydrochloride?
The InChIKey is IJJGNKYBCYCDPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.CH4N2O.ClH/c1-2-3-4-5(6)7;2-1(3)4;/h2-4H2,1H3,(H,6,7);(H4,2,3,4);1H.
What are the key properties of pentanoic acid;urea;hydrochloride?
pentanoic acid;urea;hydrochloride has a molecular weight of 198.65 g/mol, XLogP of 0.71, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoic acid;urea;hydrochloride is sourced from PubChem (CID 174794672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).