About butanimidoyl bromide
butanimidoyl bromide (PubChem CID 151001850) has the molecular formula C4H8BrN
and a molecular weight of 150.02 g/mol. Its IUPAC name is butanimidoyl bromide.
Molecular Properties
| Compound Name | butanimidoyl bromide |
| PubChem CID | 151001850 |
| Molecular Formula | C4H8BrN |
| Molecular Weight | 150.02 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | butanimidoyl bromide |
| SMILES | [H]/N=C(\Br)CCC |
| InChI | InChI=1S/C4H8BrN/c1-2-3-4(5)6/h6H,2-3H2,1H3/b6-4- |
| InChIKey | LUGOJIUAHPIRQB-XQRVVYSFSA-N |
| XLogP | 2.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.02 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butanimidoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanimidoyl bromide?
The IUPAC name of butanimidoyl bromide (CID 151001850) is butanimidoyl bromide.
What is the SMILES notation for butanimidoyl bromide?
The canonical SMILES for butanimidoyl bromide is [H]/N=C(\Br)CCC.
What is the InChIKey of butanimidoyl bromide?
The InChIKey is LUGOJIUAHPIRQB-XQRVVYSFSA-N. The full InChI is InChI=1S/C4H8BrN/c1-2-3-4(5)6/h6H,2-3H2,1H3/b6-4-.
What are the key properties of butanimidoyl bromide?
butanimidoyl bromide has a molecular weight of 150.02 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanimidoyl bromide is sourced from PubChem (CID 151001850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).