About heptan-4-imine;2-methylprop-1-ene
heptan-4-imine;2-methylprop-1-ene (PubChem CID 175527412) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is heptan-4-imine;2-methylprop-1-ene.
Molecular Properties
| Compound Name | heptan-4-imine;2-methylprop-1-ene |
| PubChem CID | 175527412 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | heptan-4-imine;2-methylprop-1-ene |
| SMILES | C=C(C)C.[H]N=C(CCC)CCC |
| InChI | InChI=1S/C7H15N.C4H8/c1-3-5-7(8)6-4-2;1-4(2)3/h8H,3-6H2,1-2H3;1H2,2-3H3 |
| InChIKey | WZNKYJCUKPHSGA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze heptan-4-imine;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-4-imine;2-methylprop-1-ene?
The IUPAC name of heptan-4-imine;2-methylprop-1-ene (CID 175527412) is heptan-4-imine;2-methylprop-1-ene.
What is the SMILES notation for heptan-4-imine;2-methylprop-1-ene?
The canonical SMILES for heptan-4-imine;2-methylprop-1-ene is C=C(C)C.[H]N=C(CCC)CCC.
What is the InChIKey of heptan-4-imine;2-methylprop-1-ene?
The InChIKey is WZNKYJCUKPHSGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C4H8/c1-3-5-7(8)6-4-2;1-4(2)3/h8H,3-6H2,1-2H3;1H2,2-3H3.
What are the key properties of heptan-4-imine;2-methylprop-1-ene?
heptan-4-imine;2-methylprop-1-ene has a molecular weight of 169.31 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-4-imine;2-methylprop-1-ene is sourced from PubChem (CID 175527412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).