About sodium;hydride;2-methylpent-1-ene
sodium;hydride;2-methylpent-1-ene (PubChem CID 174251970) has the molecular formula C6H13Na
and a molecular weight of 108.16 g/mol. Its IUPAC name is sodium;hydride;2-methylpent-1-ene.
Molecular Properties
| Compound Name | sodium;hydride;2-methylpent-1-ene |
| PubChem CID | 174251970 |
| Molecular Formula | C6H13Na |
| Molecular Weight | 108.16 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | sodium;hydride;2-methylpent-1-ene |
| SMILES | C=C(C)CCC.[H-].[Na+] |
| InChI | InChI=1S/C6H12.Na.H/c1-4-5-6(2)3;;/h2,4-5H2,1,3H3;;/q;+1;-1 |
| InChIKey | NHONTCHLYBCDND-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-methylpent-1-ene?
The IUPAC name of sodium;hydride;2-methylpent-1-ene (CID 174251970) is sodium;hydride;2-methylpent-1-ene.
What is the SMILES notation for sodium;hydride;2-methylpent-1-ene?
The canonical SMILES for sodium;hydride;2-methylpent-1-ene is C=C(C)CCC.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-methylpent-1-ene?
The InChIKey is NHONTCHLYBCDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.Na.H/c1-4-5-6(2)3;;/h2,4-5H2,1,3H3;;/q;+1;-1.
What are the key properties of sodium;hydride;2-methylpent-1-ene?
sodium;hydride;2-methylpent-1-ene has a molecular weight of 108.16 g/mol, XLogP of -0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-methylpent-1-ene is sourced from PubChem (CID 174251970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).