C8H14Cl2Pt — CID 161462927
dichloroplatinum;2,5-dimethylhexa-1,5-diene (PubChem CID 161462927) has the molecular formula C8H14Cl2Pt and a molecular weight of 376.18 g/mol. Its IUPAC name is dichloroplatinum;2,5-dimethylhexa-1,5-diene.
| Compound Name | dichloroplatinum;2,5-dimethylhexa-1,5-diene |
|---|---|
| PubChem CID | 161462927 |
| Molecular Formula | C8H14Cl2Pt |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | dichloroplatinum;2,5-dimethylhexa-1,5-diene |
| SMILES | C=C(C)CCC(=C)C.Cl[Pt]Cl |
| InChI | InChI=1S/C8H14.2ClH.Pt/c1-7(2)5-6-8(3)4;;;/h1,3,5-6H2,2,4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | WCBAKFDQBABMHZ-UHFFFAOYSA-L |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|