C28H58 — CID 156639867
2,20-dimethylhenicosa-1,20-diene;ethane;propane (PubChem CID 156639867) has the molecular formula C28H58 and a molecular weight of 394.77 g/mol. Its IUPAC name is 2,20-dimethylhenicosa-1,20-diene;ethane;propane.
| Compound Name | 2,20-dimethylhenicosa-1,20-diene;ethane;propane |
|---|---|
| PubChem CID | 156639867 |
| Molecular Formula | C28H58 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.45 |
| IUPAC Name | 2,20-dimethylhenicosa-1,20-diene;ethane;propane |
| SMILES | C=C(C)CCCCCCCCCCCCCCCCCC(=C)C.CC.CCC |
| InChI | InChI=1S/C23H44.C3H8.C2H6/c1-22(2)20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-23(3)4;1-3-2;1-2/h1,3,5-21H2,2,4H3;3H2,1-2H3;1-2H3 |
| InChIKey | WAQQKYJLKMGIKR-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|