About ethane;2-methylhept-1-ene
ethane;2-methylhept-1-ene (PubChem CID 143682307) has the molecular formula C14H34
and a molecular weight of 202.43 g/mol. Its IUPAC name is ethane;2-methylhept-1-ene.
Molecular Properties
| Compound Name | ethane;2-methylhept-1-ene |
| PubChem CID | 143682307 |
| Molecular Formula | C14H34 |
| Molecular Weight | 202.43 g/mol |
| Exact Mass | 202.27 |
| IUPAC Name | ethane;2-methylhept-1-ene |
| SMILES | C=C(C)CCCCC.CC.CC.CC |
| InChI | InChI=1S/C8H16.3C2H6/c1-4-5-6-7-8(2)3;3*1-2/h2,4-7H2,1,3H3;3*1-2H3 |
| InChIKey | AISZBERKTZNJMB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylhept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylhept-1-ene?
The IUPAC name of ethane;2-methylhept-1-ene (CID 143682307) is ethane;2-methylhept-1-ene.
What is the SMILES notation for ethane;2-methylhept-1-ene?
The canonical SMILES for ethane;2-methylhept-1-ene is C=C(C)CCCCC.CC.CC.CC.
What is the InChIKey of ethane;2-methylhept-1-ene?
The InChIKey is AISZBERKTZNJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.3C2H6/c1-4-5-6-7-8(2)3;3*1-2/h2,4-7H2,1,3H3;3*1-2H3.
What are the key properties of ethane;2-methylhept-1-ene?
ethane;2-methylhept-1-ene has a molecular weight of 202.43 g/mol, XLogP of 6.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylhept-1-ene is sourced from PubChem (CID 143682307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).