C10H19+ — CID 174323451
2,7-dimethylocta-1,7-diene;hydron (PubChem CID 174323451) has the molecular formula C10H19+ and a molecular weight of 139.26 g/mol. Its IUPAC name is 2,7-dimethylocta-1,7-diene;hydron.
| Compound Name | 2,7-dimethylocta-1,7-diene;hydron |
|---|---|
| PubChem CID | 174323451 |
| Molecular Formula | C10H19+ |
| Molecular Weight | 139.26 g/mol |
| Exact Mass | 139.15 |
| IUPAC Name | 2,7-dimethylocta-1,7-diene;hydron |
| SMILES | C=C(C)CCCCC(=C)C.[H+] |
| InChI | InChI=1S/C10H18/c1-9(2)7-5-6-8-10(3)4/h1,3,5-8H2,2,4H3/p+1 |
| InChIKey | ZKLZBMDZTNAIST-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|