About ethane;2-methyloct-1-ene
ethane;2-methyloct-1-ene (PubChem CID 143077596) has the molecular formula C11H24
and a molecular weight of 156.31 g/mol. Its IUPAC name is ethane;2-methyloct-1-ene.
Molecular Properties
| Compound Name | ethane;2-methyloct-1-ene |
| PubChem CID | 143077596 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | ethane;2-methyloct-1-ene |
| SMILES | C=C(C)CCCCCC.CC |
| InChI | InChI=1S/C9H18.C2H6/c1-4-5-6-7-8-9(2)3;1-2/h2,4-8H2,1,3H3;1-2H3 |
| InChIKey | HQOVXZOKBPGNOF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyloct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyloct-1-ene?
The IUPAC name of ethane;2-methyloct-1-ene (CID 143077596) is ethane;2-methyloct-1-ene.
What is the SMILES notation for ethane;2-methyloct-1-ene?
The canonical SMILES for ethane;2-methyloct-1-ene is C=C(C)CCCCCC.CC.
What is the InChIKey of ethane;2-methyloct-1-ene?
The InChIKey is HQOVXZOKBPGNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C2H6/c1-4-5-6-7-8-9(2)3;1-2/h2,4-8H2,1,3H3;1-2H3.
What are the key properties of ethane;2-methyloct-1-ene?
ethane;2-methyloct-1-ene has a molecular weight of 156.31 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyloct-1-ene is sourced from PubChem (CID 143077596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).