C16H30Cl2 — CID 88686201
2,5-dichloro-2,5-dimethylhexane;2,5-dimethylhexa-1,5-diene (PubChem CID 88686201) has the molecular formula C16H30Cl2 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2,5-dichloro-2,5-dimethylhexane;2,5-dimethylhexa-1,5-diene.
| Compound Name | 2,5-dichloro-2,5-dimethylhexane;2,5-dimethylhexa-1,5-diene |
|---|---|
| PubChem CID | 88686201 |
| Molecular Formula | C16H30Cl2 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2,5-dichloro-2,5-dimethylhexane;2,5-dimethylhexa-1,5-diene |
| SMILES | C=C(C)CCC(=C)C.CC(C)(Cl)CCC(C)(C)Cl |
| InChI | InChI=1S/C8H16Cl2.C8H14/c1-7(2,9)5-6-8(3,4)10;1-7(2)5-6-8(3)4/h5-6H2,1-4H3;1,3,5-6H2,2,4H3 |
| InChIKey | HJIUBZVINRZDHI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|