About (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane
(5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane (PubChem CID 144526797) has the molecular formula C16H36
and a molecular weight of 228.46 g/mol. Its IUPAC name is (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane.
Molecular Properties
| Compound Name | (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane |
| PubChem CID | 144526797 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane |
| SMILES | C=C(C)CC/C(C)=C\C.CC.CC.CCC |
| InChI | InChI=1S/C9H16.C3H8.2C2H6/c1-5-9(4)7-6-8(2)3;1-3-2;2*1-2/h5H,2,6-7H2,1,3-4H3;3H2,1-2H3;2*1-2H3/b9-5-;;; |
| InChIKey | PKETYPHLYQTKBR-WNRDOTPUSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane?
The IUPAC name of (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane (CID 144526797) is (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane.
What is the SMILES notation for (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane?
The canonical SMILES for (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane is C=C(C)CC/C(C)=C\C.CC.CC.CCC.
What is the InChIKey of (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane?
The InChIKey is PKETYPHLYQTKBR-WNRDOTPUSA-N. The full InChI is InChI=1S/C9H16.C3H8.2C2H6/c1-5-9(4)7-6-8(2)3;1-3-2;2*1-2/h5H,2,6-7H2,1,3-4H3;3H2,1-2H3;2*1-2H3/b9-5-;;;.
What are the key properties of (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane?
(5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane has a molecular weight of 228.46 g/mol, XLogP of 6.78, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane is sourced from PubChem (CID 144526797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).