C16H36 — CID 144526797
(5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane (PubChem CID 144526797) has the molecular formula C16H36 and a molecular weight of 228.46 g/mol. Its IUPAC name is (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane.
| Compound Name | (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane |
|---|---|
| PubChem CID | 144526797 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | (5Z)-2,5-dimethylhepta-1,5-diene;ethane;propane |
| SMILES | C=C(C)CC/C(C)=C\C.CC.CC.CCC |
| InChI | InChI=1S/C9H16.C3H8.2C2H6/c1-5-9(4)7-6-8(2)3;1-3-2;2*1-2/h5H,2,6-7H2,1,3-4H3;3H2,1-2H3;2*1-2H3/b9-5-;;; |
| InChIKey | PKETYPHLYQTKBR-WNRDOTPUSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|