C16H28 — CID 145317472
(5E,9E)-2,5,9-trimethyltrideca-1,5,9-triene (PubChem CID 145317472) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is (5E,9E)-2,5,9-trimethyltrideca-1,5,9-triene.
| Compound Name | (5E,9E)-2,5,9-trimethyltrideca-1,5,9-triene |
|---|---|
| PubChem CID | 145317472 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | (5E,9E)-2,5,9-trimethyltrideca-1,5,9-triene |
| SMILES | C=C(C)CC/C(C)=C/CC/C(C)=C/CCC |
| InChI | InChI=1S/C16H28/c1-6-7-9-15(4)10-8-11-16(5)13-12-14(2)3/h9,11H,2,6-8,10,12-13H2,1,3-5H3/b15-9+,16-11+ |
| InChIKey | JOKGTJRQQWDCCK-XGGJEREUSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|