C13H22 — CID 172676180
(3E)-4,8-dimethylundeca-1,3,7-triene (PubChem CID 172676180) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (3E)-4,8-dimethylundeca-1,3,7-triene.
| Compound Name | (3E)-4,8-dimethylundeca-1,3,7-triene |
|---|---|
| PubChem CID | 172676180 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (3E)-4,8-dimethylundeca-1,3,7-triene |
| SMILES | C=C/C=C(\C)CCC=C(C)CCC |
| InChI | InChI=1S/C13H22/c1-5-8-12(3)10-7-11-13(4)9-6-2/h5,8,11H,1,6-7,9-10H2,2-4H3/b12-8+,13-11? |
| InChIKey | PPFQRPLVFLBIGC-YUVOZZMTSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|