C17H30 — CID 123749703
10,10-diethyl-4-methyldodeca-1,3,7-triene (PubChem CID 123749703) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 10,10-diethyl-4-methyldodeca-1,3,7-triene.
| Compound Name | 10,10-diethyl-4-methyldodeca-1,3,7-triene |
|---|---|
| PubChem CID | 123749703 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 10,10-diethyl-4-methyldodeca-1,3,7-triene |
| SMILES | C=CC=C(C)CCC=CCC(CC)(CC)CC |
| InChI | InChI=1S/C17H30/c1-6-13-16(5)14-11-10-12-15-17(7-2,8-3)9-4/h6,10,12-13H,1,7-9,11,14-15H2,2-5H3 |
| InChIKey | MGZLRTMDVCWAJM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|