C12H21N — CID 163243762
(2E,6E)-3-methylocta-2,6-dien-1-imine;prop-1-ene (PubChem CID 163243762) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2E,6E)-3-methylocta-2,6-dien-1-imine;prop-1-ene.
| Compound Name | (2E,6E)-3-methylocta-2,6-dien-1-imine;prop-1-ene |
|---|---|
| PubChem CID | 163243762 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2E,6E)-3-methylocta-2,6-dien-1-imine;prop-1-ene |
| SMILES | C=CC.[H]/N=C/C=C(\C)CC/C=C/C |
| InChI | InChI=1S/C9H15N.C3H6/c1-3-4-5-6-9(2)7-8-10;1-3-2/h3-4,7-8,10H,5-6H2,1-2H3;3H,1H2,2H3/b4-3+,9-7+,10-8+; |
| InChIKey | CKCGJRFADYMTTJ-DWPASODKSA-N |
| XLogP | 4.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|