C28H46 — CID 102073218
(2Z,6E,10E,14E,18E,22Z)-6,10,15,19-tetramethyltetracosa-2,6,10,14,18,22-hexaene (PubChem CID 102073218) has the molecular formula C28H46 and a molecular weight of 382.68 g/mol. Its IUPAC name is (2Z,6E,10E,14E,18E,22Z)-6,10,15,19-tetramethyltetracosa-2,6,10,14,18,22-hexaene.
| Compound Name | (2Z,6E,10E,14E,18E,22Z)-6,10,15,19-tetramethyltetracosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 102073218 |
| Molecular Formula | C28H46 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | (2Z,6E,10E,14E,18E,22Z)-6,10,15,19-tetramethyltetracosa-2,6,10,14,18,22-hexaene |
| SMILES | C/C=C\CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CC/C=C\C |
| InChI | InChI=1S/C28H46/c1-7-9-11-17-25(3)21-15-23-27(5)19-13-14-20-28(6)24-16-22-26(4)18-12-10-8-2/h7-10,19-22H,11-18,23-24H2,1-6H3/b9-7-,10-8-,25-21+,26-22+,27-19+,28-20+ |
| InChIKey | WVSXXJJXDXBNEM-GKEGQBNQSA-N |
| XLogP | 9.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|