C26H38F4 — CID 15119646
(5E,9E,13E,17E)-1,1,22,22-tetrafluoro-5,9,14,18-tetramethyldocosa-1,5,9,13,17,21-hexaene (PubChem CID 15119646) has the molecular formula C26H38F4 and a molecular weight of 426.58 g/mol. Its IUPAC name is (5E,9E,13E,17E)-1,1,22,22-tetrafluoro-5,9,14,18-tetramethyldocosa-1,5,9,13,17,21-hexaene.
| Compound Name | (5E,9E,13E,17E)-1,1,22,22-tetrafluoro-5,9,14,18-tetramethyldocosa-1,5,9,13,17,21-hexaene |
|---|---|
| PubChem CID | 15119646 |
| Molecular Formula | C26H38F4 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (5E,9E,13E,17E)-1,1,22,22-tetrafluoro-5,9,14,18-tetramethyldocosa-1,5,9,13,17,21-hexaene |
| SMILES | C/C(=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(F)F)CCC=C(F)F |
| InChI | InChI=1S/C26H38F4/c1-21(13-7-15-23(3)17-9-19-25(27)28)11-5-6-12-22(2)14-8-16-24(4)18-10-20-26(29)30/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3/b21-11+,22-12+,23-15+,24-16+ |
| InChIKey | LNRHWXXZTZKKRR-GENXYJBDSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|