C11H16F2 — CID 11148129
(3E)-1,1-difluoro-4,8-dimethylnona-1,3,7-triene (PubChem CID 11148129) has the molecular formula C11H16F2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3E)-1,1-difluoro-4,8-dimethylnona-1,3,7-triene.
| Compound Name | (3E)-1,1-difluoro-4,8-dimethylnona-1,3,7-triene |
|---|---|
| PubChem CID | 11148129 |
| Molecular Formula | C11H16F2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (3E)-1,1-difluoro-4,8-dimethylnona-1,3,7-triene |
| SMILES | CC(C)=CCC/C(C)=C/C=C(F)F |
| InChI | InChI=1S/C11H16F2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h5,7-8H,4,6H2,1-3H3/b10-7+ |
| InChIKey | CSVXOUZGAOOAQY-JXMROGBWSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|