C12H19F — CID 73411750
2-fluoro-5,9-dimethyldeca-2,4,8-triene (PubChem CID 73411750) has the molecular formula C12H19F and a molecular weight of 182.28 g/mol. Its IUPAC name is 2-fluoro-5,9-dimethyldeca-2,4,8-triene.
| Compound Name | 2-fluoro-5,9-dimethyldeca-2,4,8-triene |
|---|---|
| PubChem CID | 73411750 |
| Molecular Formula | C12H19F |
| Molecular Weight | 182.28 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-fluoro-5,9-dimethyldeca-2,4,8-triene |
| SMILES | CC(C)=CCCC(C)=CC=C(C)F |
| InChI | InChI=1S/C12H19F/c1-10(2)6-5-7-11(3)8-9-12(4)13/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | YCPSQSABVXFVSG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|