C13H16N2 — CID 21159982
2-[(2Z)-3,7-dimethylocta-2,6-dienylidene]propanedinitrile (PubChem CID 21159982) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[(2Z)-3,7-dimethylocta-2,6-dienylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-3,7-dimethylocta-2,6-dienylidene]propanedinitrile |
|---|---|
| PubChem CID | 21159982 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[(2Z)-3,7-dimethylocta-2,6-dienylidene]propanedinitrile |
| SMILES | CC(C)=CCC/C(C)=C\C=C(C#N)C#N |
| InChI | InChI=1S/C13H16N2/c1-11(2)5-4-6-12(3)7-8-13(9-14)10-15/h5,7-8H,4,6H2,1-3H3/b12-7- |
| InChIKey | ZUJSNEUIQOHGIK-GHXNOFRVSA-N |
| XLogP | 3.65 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|