C16H22N2 — CID 11053838
2-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]propanedinitrile (PubChem CID 11053838) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]propanedinitrile.
| Compound Name | 2-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11053838 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-[(5E)-6,10-dimethylundeca-5,9-dien-2-ylidene]propanedinitrile |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)=C(C#N)C#N |
| InChI | InChI=1S/C16H22N2/c1-13(2)7-5-8-14(3)9-6-10-15(4)16(11-17)12-18/h7,9H,5-6,8,10H2,1-4H3/b14-9+ |
| InChIKey | LUICEHGNJPJTDG-NTEUORMPSA-N |
| XLogP | 4.82 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|