C20H33ClO — CID 168749375
(2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 168749375) has the molecular formula C20H33ClO and a molecular weight of 324.94 g/mol. Its IUPAC name is (2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | (2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 168749375 |
| Molecular Formula | C20H33ClO |
| Molecular Weight | 324.94 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C(\Cl)CO |
| InChI | InChI=1S/C20H33ClO/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)20(21)15-22/h9,11,13,22H,6-8,10,12,14-15H2,1-5H3/b17-11+,18-13+,20-19- |
| InChIKey | BOWVRCIPHIKAAT-HAQLZSGTSA-N |
| XLogP | 6.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.94 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|