C10H15N — CID 10796920
(2E)-3,7-dimethyl(413C)octa-2,6-dienenitrile (PubChem CID 10796920) has the molecular formula C10H15N and a molecular weight of 150.23 g/mol. Its IUPAC name is (2E)-3,7-dimethyl(413C)octa-2,6-dienenitrile.
| Compound Name | (2E)-3,7-dimethyl(413C)octa-2,6-dienenitrile |
|---|---|
| PubChem CID | 10796920 |
| Molecular Formula | C10H15N |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2E)-3,7-dimethyl(413C)octa-2,6-dienenitrile |
| SMILES | CC(C)=CC[13CH2]/C(C)=C/C#N |
| InChI | InChI=1S/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6H2,1-3H3/b10-7+/i6+1 |
| InChIKey | HLCSDJLATUNSSI-JMEVZBHSSA-N |
| XLogP | 3.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|