C19H22N2 — CID 157177195
(2E)-3,7-dimethylocta-2,6-dienenitrile;(E)-3-phenylprop-2-enenitrile (PubChem CID 157177195) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dienenitrile;(E)-3-phenylprop-2-enenitrile.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dienenitrile;(E)-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 157177195 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dienenitrile;(E)-3-phenylprop-2-enenitrile |
| SMILES | CC(C)=CCC/C(C)=C/C#N.N#C/C=C/c1ccccc1 |
| InChI | InChI=1S/C10H15N.C9H7N/c1-9(2)5-4-6-10(3)7-8-11;10-8-4-7-9-5-2-1-3-6-9/h5,7H,4,6H2,1-3H3;1-7H/b10-7+;7-4+ |
| InChIKey | AODNGAMELIGJTC-OIDVRDPVSA-N |
| XLogP | 5.43 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|