C15H13NO2 — CID 57196358
5,6-dioxo-3-(2-phenylethenyl)hept-2-enenitrile (PubChem CID 57196358) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5,6-dioxo-3-(2-phenylethenyl)hept-2-enenitrile.
| Compound Name | 5,6-dioxo-3-(2-phenylethenyl)hept-2-enenitrile |
|---|---|
| PubChem CID | 57196358 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 5,6-dioxo-3-(2-phenylethenyl)hept-2-enenitrile |
| SMILES | CC(=O)C(=O)CC(C=Cc1ccccc1)=CC#N |
| InChI | InChI=1S/C15H13NO2/c1-12(17)15(18)11-14(9-10-16)8-7-13-5-3-2-4-6-13/h2-9H,11H2,1H3 |
| InChIKey | OIMKRNNGEBJNOI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|