C12H11N3O2 — CID 582984
2-cyano-N'-(3-phenylprop-2-enoyl)acetohydrazide (PubChem CID 582984) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-cyano-N'-(3-phenylprop-2-enoyl)acetohydrazide.
| Compound Name | 2-cyano-N'-(3-phenylprop-2-enoyl)acetohydrazide |
|---|---|
| PubChem CID | 582984 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-cyano-N'-(3-phenylprop-2-enoyl)acetohydrazide |
| SMILES | N#CCC(=O)NNC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C12H11N3O2/c13-9-8-12(17)15-14-11(16)7-6-10-4-2-1-3-5-10/h1-7H,8H2,(H,14,16)(H,15,17) |
| InChIKey | XKFOTKKAHPZVOO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|