C19H17N3O2 — CID 108924167
2-cyano-N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]acetamide (PubChem CID 108924167) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-cyano-N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 108924167 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-cyano-N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1cccc(CNC(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C19H17N3O2/c20-12-11-19(24)22-17-8-4-7-16(13-17)14-21-18(23)10-9-15-5-2-1-3-6-15/h1-10,13H,11,14H2,(H,21,23)(H,22,24)/b10-9+ |
| InChIKey | QHCOOJFXIXALAJ-MDZDMXLPSA-N |
| XLogP | 2.87 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|