C17H21N3O2 — CID 108924210
(E)-N-[3-[[(2-cyanoacetyl)amino]methyl]phenyl]-4,4-dimethylpent-2-enamide (PubChem CID 108924210) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is (E)-N-[3-[[(2-cyanoacetyl)amino]methyl]phenyl]-4,4-dimethylpent-2-enamide.
| Compound Name | (E)-N-[3-[[(2-cyanoacetyl)amino]methyl]phenyl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 108924210 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (E)-N-[3-[[(2-cyanoacetyl)amino]methyl]phenyl]-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)/C=C/C(=O)Nc1cccc(CNC(=O)CC#N)c1 |
| InChI | InChI=1S/C17H21N3O2/c1-17(2,3)9-7-16(22)20-14-6-4-5-13(11-14)12-19-15(21)8-10-18/h4-7,9,11H,8,12H2,1-3H3,(H,19,21)(H,20,22)/b9-7+ |
| InChIKey | XWUFMYWMWVNGCY-VQHVLOKHSA-N |
| XLogP | 2.76 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|