C16H19N3O2 — CID 108923032
(E)-N-[2-[(2-cyanoacetyl)amino]phenyl]-4,4-dimethylpent-2-enamide (PubChem CID 108923032) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (E)-N-[2-[(2-cyanoacetyl)amino]phenyl]-4,4-dimethylpent-2-enamide.
| Compound Name | (E)-N-[2-[(2-cyanoacetyl)amino]phenyl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 108923032 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (E)-N-[2-[(2-cyanoacetyl)amino]phenyl]-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)/C=C/C(=O)Nc1ccccc1NC(=O)CC#N |
| InChI | InChI=1S/C16H19N3O2/c1-16(2,3)10-8-14(20)18-12-6-4-5-7-13(12)19-15(21)9-11-17/h4-8,10H,9H2,1-3H3,(H,18,20)(H,19,21)/b10-8+ |
| InChIKey | RPRSRFOQMHNJSD-CSKARUKUSA-N |
| XLogP | 3.08 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|