C13H21N3O2 — CID 108924421
(E)-N-[3-[(2-cyanoacetyl)amino]propyl]-4,4-dimethylpent-2-enamide (PubChem CID 108924421) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is (E)-N-[3-[(2-cyanoacetyl)amino]propyl]-4,4-dimethylpent-2-enamide.
| Compound Name | (E)-N-[3-[(2-cyanoacetyl)amino]propyl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 108924421 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (E)-N-[3-[(2-cyanoacetyl)amino]propyl]-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)/C=C/C(=O)NCCCNC(=O)CC#N |
| InChI | InChI=1S/C13H21N3O2/c1-13(2,3)7-5-11(17)15-9-4-10-16-12(18)6-8-14/h5,7H,4,6,9-10H2,1-3H3,(H,15,17)(H,16,18)/b7-5+ |
| InChIKey | JPNRCEQDXQUBHC-FNORWQNLSA-N |
| XLogP | 1.12 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|