C11H17N3O3 — CID 54267162
prop-2-enyl N-[4-[(2-cyanoacetyl)amino]butyl]carbamate (PubChem CID 54267162) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is prop-2-enyl N-[4-[(2-cyanoacetyl)amino]butyl]carbamate.
| Compound Name | prop-2-enyl N-[4-[(2-cyanoacetyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 54267162 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | prop-2-enyl N-[4-[(2-cyanoacetyl)amino]butyl]carbamate |
| SMILES | C=CCOC(=O)NCCCCNC(=O)CC#N |
| InChI | InChI=1S/C11H17N3O3/c1-2-9-17-11(16)14-8-4-3-7-13-10(15)5-6-12/h2H,1,3-5,7-9H2,(H,13,15)(H,14,16) |
| InChIKey | RHOQMPLWMYKQSM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|