C10H21NO5Si — CID 18672768
prop-2-enyl N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 18672768) has the molecular formula C10H21NO5Si and a molecular weight of 263.37 g/mol. Its IUPAC name is prop-2-enyl N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | prop-2-enyl N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 18672768 |
| Molecular Formula | C10H21NO5Si |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | prop-2-enyl N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | C=CCOC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H21NO5Si/c1-5-8-16-10(12)11-7-6-9-17(13-2,14-3)15-4/h5H,1,6-9H2,2-4H3,(H,11,12) |
| InChIKey | NVFSQYYDIQKEPA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|