C16H27NO9Si — CID 59812257
[3-prop-2-enoyloxy-2-(3-trimethoxysilylpropylcarbamoyloxy)propyl] prop-2-enoate (PubChem CID 59812257) has the molecular formula C16H27NO9Si and a molecular weight of 405.48 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-2-(3-trimethoxysilylpropylcarbamoyloxy)propyl] prop-2-enoate.
| Compound Name | [3-prop-2-enoyloxy-2-(3-trimethoxysilylpropylcarbamoyloxy)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 59812257 |
| Molecular Formula | C16H27NO9Si |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [3-prop-2-enoyloxy-2-(3-trimethoxysilylpropylcarbamoyloxy)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)OC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C16H27NO9Si/c1-6-14(18)24-11-13(12-25-15(19)7-2)26-16(20)17-9-8-10-27(21-3,22-4)23-5/h6-7,13H,1-2,8-12H2,3-5H3,(H,17,20) |
| InChIKey | PABJLZSFNZHYLW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|