C29H42N2O12 — CID 144517457
[2-[3-[6-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]hexylamino]oxiran-2-yl]oxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate (PubChem CID 144517457) has the molecular formula C29H42N2O12 and a molecular weight of 610.66 g/mol. Its IUPAC name is [2-[3-[6-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]hexylamino]oxiran-2-yl]oxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[3-[6-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]hexylamino]oxiran-2-yl]oxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144517457 |
| Molecular Formula | C29H42N2O12 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | [2-[3-[6-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]hexylamino]oxiran-2-yl]oxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C(=C)C)OC(=O)NCCCCCCNC1OC1OC(COC(=O)C=C)COC(=O)C(=C)C |
| InChI | InChI=1S/C29H42N2O12/c1-7-23(32)37-15-21(17-39-26(34)19(3)4)41-28-25(43-28)30-13-11-9-10-12-14-31-29(36)42-22(16-38-24(33)8-2)18-40-27(35)20(5)6/h7-8,21-22,25,28,30H,1-3,5,9-18H2,4,6H3,(H,31,36) |
| InChIKey | OHNXRCWWCSHULK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 177.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|