C21H29NO9 — CID 88955036
1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-methyl-3-oxo-3-(3-prop-2-enoyloxypropylamino)propanoate (PubChem CID 88955036) has the molecular formula C21H29NO9 and a molecular weight of 439.46 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-methyl-3-oxo-3-(3-prop-2-enoyloxypropylamino)propanoate.
| Compound Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-methyl-3-oxo-3-(3-prop-2-enoyloxypropylamino)propanoate |
|---|---|
| PubChem CID | 88955036 |
| Molecular Formula | C21H29NO9 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-methyl-3-oxo-3-(3-prop-2-enoyloxypropylamino)propanoate |
| SMILES | C=CC(=O)OCCCNC(=O)C(C)C(=O)OC(COC(=O)C(=C)C)COC(=O)C(=C)C |
| InChI | InChI=1S/C21H29NO9/c1-7-17(23)28-10-8-9-22-18(24)15(6)21(27)31-16(11-29-19(25)13(2)3)12-30-20(26)14(4)5/h7,15-16H,1-2,4,8-12H2,3,5-6H3,(H,22,24) |
| InChIKey | IJXQBOPDSBEDMM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|