C13H16O6 — CID 57056208
1,3-di(prop-2-enoyloxy)propan-2-yl 2-methylprop-2-enoate (PubChem CID 57056208) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is 1,3-di(prop-2-enoyloxy)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1,3-di(prop-2-enoyloxy)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57056208 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1,3-di(prop-2-enoyloxy)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H16O6/c1-5-11(14)17-7-10(8-18-12(15)6-2)19-13(16)9(3)4/h5-6,10H,1-3,7-8H2,4H3 |
| InChIKey | MDNDHRBMKKYWSO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|