C14H18O8 — CID 22505843
[2-(3-oxobutanoyloxy)-3-prop-2-enoyloxypropyl] 3-oxobutanoate (PubChem CID 22505843) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is [2-(3-oxobutanoyloxy)-3-prop-2-enoyloxypropyl] 3-oxobutanoate.
| Compound Name | [2-(3-oxobutanoyloxy)-3-prop-2-enoyloxypropyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 22505843 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [2-(3-oxobutanoyloxy)-3-prop-2-enoyloxypropyl] 3-oxobutanoate |
| SMILES | C=CC(=O)OCC(COC(=O)CC(C)=O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C14H18O8/c1-4-12(17)20-7-11(22-14(19)6-10(3)16)8-21-13(18)5-9(2)15/h4,11H,1,5-8H2,2-3H3 |
| InChIKey | KKXQNKGNFHIUKL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|