C18H26O11 — CID 166042043
[3-[2,3-bis(3-oxobutanoyloxy)propoxy]-2-hydroxypropyl] 3-oxobutanoate (PubChem CID 166042043) has the molecular formula C18H26O11 and a molecular weight of 418.40 g/mol. Its IUPAC name is [3-[2,3-bis(3-oxobutanoyloxy)propoxy]-2-hydroxypropyl] 3-oxobutanoate.
| Compound Name | [3-[2,3-bis(3-oxobutanoyloxy)propoxy]-2-hydroxypropyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 166042043 |
| Molecular Formula | C18H26O11 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [3-[2,3-bis(3-oxobutanoyloxy)propoxy]-2-hydroxypropyl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC(O)COCC(COC(=O)CC(C)=O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C18H26O11/c1-11(19)4-16(23)27-8-14(22)7-26-9-15(29-18(25)6-13(3)21)10-28-17(24)5-12(2)20/h14-15,22H,4-10H2,1-3H3 |
| InChIKey | UDLSQYLMHXKQLB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|