C22H38O9 — CID 551549
[2-butanoyloxy-3-[2,3-di(butanoyloxy)propoxy]propyl] butanoate (PubChem CID 551549) has the molecular formula C22H38O9 and a molecular weight of 446.54 g/mol. Its IUPAC name is [2-butanoyloxy-3-[2,3-di(butanoyloxy)propoxy]propyl] butanoate.
| Compound Name | [2-butanoyloxy-3-[2,3-di(butanoyloxy)propoxy]propyl] butanoate |
|---|---|
| PubChem CID | 551549 |
| Molecular Formula | C22H38O9 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [2-butanoyloxy-3-[2,3-di(butanoyloxy)propoxy]propyl] butanoate |
| SMILES | CCCC(=O)OCC(COCC(COC(=O)CCC)OC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C22H38O9/c1-5-9-19(23)28-15-17(30-21(25)11-7-3)13-27-14-18(31-22(26)12-8-4)16-29-20(24)10-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | UPAKPZTWJDXWSM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|