C18H30O8 — CID 159327262
4-O-[1,3-di(butanoyloxy)propan-2-yl] 1-O-propyl butanedioate (PubChem CID 159327262) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is 4-O-[1,3-di(butanoyloxy)propan-2-yl] 1-O-propyl butanedioate.
| Compound Name | 4-O-[1,3-di(butanoyloxy)propan-2-yl] 1-O-propyl butanedioate |
|---|---|
| PubChem CID | 159327262 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-O-[1,3-di(butanoyloxy)propan-2-yl] 1-O-propyl butanedioate |
| SMILES | CCCOC(=O)CCC(=O)OC(COC(=O)CCC)COC(=O)CCC |
| InChI | InChI=1S/C18H30O8/c1-4-7-15(19)24-12-14(13-25-16(20)8-5-2)26-18(22)10-9-17(21)23-11-6-3/h14H,4-13H2,1-3H3 |
| InChIKey | AFPLIDJQXSAYTE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|